C10H21NO4S — CID 106160353
4-[(5-hydroxy-4-methylpentyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 106160353) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-[(5-hydroxy-4-methylpentyl)amino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[(5-hydroxy-4-methylpentyl)amino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 106160353 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(5-hydroxy-4-methylpentyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(CO)CCCNC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C10H21NO4S/c1-8(5-12)3-2-4-11-9-6-16(14,15)7-10(9)13/h8-13H,2-7H2,1H3 |
| InChIKey | FHRUXPYTOKNGOJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|