C7H15NO3S — CID 7138714
(3S,4S)-1,1-dioxo-4-(propylamino)thiolan-3-ol (PubChem CID 7138714) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is (3S,4S)-1,1-dioxo-4-(propylamino)thiolan-3-ol.
| Compound Name | (3S,4S)-1,1-dioxo-4-(propylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 7138714 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (3S,4S)-1,1-dioxo-4-(propylamino)thiolan-3-ol |
| SMILES | CCCN[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C7H15NO3S/c1-2-3-8-6-4-12(10,11)5-7(6)9/h6-9H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | USKDSTKQCUZVGP-RNFRBKRXSA-N |
| XLogP | -0.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |