C7H11NO3S — CID 51889343
(3R,4R)-1,1-dioxo-4-(prop-2-ynylamino)thiolan-3-ol (PubChem CID 51889343) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is (3R,4R)-1,1-dioxo-4-(prop-2-ynylamino)thiolan-3-ol.
| Compound Name | (3R,4R)-1,1-dioxo-4-(prop-2-ynylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 51889343 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (3R,4R)-1,1-dioxo-4-(prop-2-ynylamino)thiolan-3-ol |
| SMILES | C#CCN[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C7H11NO3S/c1-2-3-8-6-4-12(10,11)5-7(6)9/h1,6-9H,3-5H2/t6-,7-/m0/s1 |
| InChIKey | SNJVKENPYDRUAO-BQBZGAKWSA-N |
| XLogP | -1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|