C8H16N2O6S2 — CID 3831220
4-[2-(4-hydroxy-1,1-dioxothiolan-3-yl)hydrazinyl]-1,1-dioxothiolan-3-ol (PubChem CID 3831220) has the molecular formula C8H16N2O6S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-1,1-dioxothiolan-3-yl)hydrazinyl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-(4-hydroxy-1,1-dioxothiolan-3-yl)hydrazinyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 3831220 |
| Molecular Formula | C8H16N2O6S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 4-[2-(4-hydroxy-1,1-dioxothiolan-3-yl)hydrazinyl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NNC2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C8H16N2O6S2/c11-7-3-17(13,14)1-5(7)9-10-6-2-18(15,16)4-8(6)12/h5-12H,1-4H2 |
| InChIKey | VMFLIANSPJLKSS-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|