C11H13NO5S — CID 95795312
4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoic acid (PubChem CID 95795312) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoic acid.
| Compound Name | 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 95795312 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N[C@@H]2CS(=O)(=O)C[C@H]2O)cc1 |
| InChI | InChI=1S/C11H13NO5S/c13-10-6-18(16,17)5-9(10)12-8-3-1-7(2-4-8)11(14)15/h1-4,9-10,12-13H,5-6H2,(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | BGDPPRWLIUKOOP-NXEZZACHSA-N |
| XLogP | -0.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |