C10H13NO4S — CID 3635149
4-(2-hydroxyanilino)-1,1-dioxothiolan-3-ol (PubChem CID 3635149) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 4-(2-hydroxyanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2-hydroxyanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 3635149 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-(2-hydroxyanilino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Nc2ccccc2O)C1 |
| InChI | InChI=1S/C10H13NO4S/c12-9-4-2-1-3-7(9)11-8-5-16(14,15)6-10(8)13/h1-4,8,10-13H,5-6H2 |
| InChIKey | ODAGVBLMGXFRCD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|