C11H14BrNO3S — CID 60884246
4-(2-bromo-4-methylanilino)-1,1-dioxothiolan-3-ol (PubChem CID 60884246) has the molecular formula C11H14BrNO3S and a molecular weight of 320.21 g/mol. Its IUPAC name is 4-(2-bromo-4-methylanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2-bromo-4-methylanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60884246 |
| Molecular Formula | C11H14BrNO3S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 4-(2-bromo-4-methylanilino)-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccc(NC2CS(=O)(=O)CC2O)c(Br)c1 |
| InChI | InChI=1S/C11H14BrNO3S/c1-7-2-3-9(8(12)4-7)13-10-5-17(15,16)6-11(10)14/h2-4,10-11,13-14H,5-6H2,1H3 |
| InChIKey | IFTGHUTZCRMETF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |