C13H19NO3S — CID 1413789
(3R,4R)-4-(2-ethyl-6-methylanilino)-1,1-dioxothiolan-3-ol (PubChem CID 1413789) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is (3R,4R)-4-(2-ethyl-6-methylanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-(2-ethyl-6-methylanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 1413789 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (3R,4R)-4-(2-ethyl-6-methylanilino)-1,1-dioxothiolan-3-ol |
| SMILES | CCc1cccc(C)c1N[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C13H19NO3S/c1-3-10-6-4-5-9(2)13(10)14-11-7-18(16,17)8-12(11)15/h4-6,11-12,14-15H,3,7-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BECCBXQANAQTNG-RYUDHWBXSA-N |
| XLogP | 1.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |