C12H16N2O5S — CID 103114941
4-[(2-methyl-3-nitrophenyl)methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 103114941) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-[(2-methyl-3-nitrophenyl)methylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[(2-methyl-3-nitrophenyl)methylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 103114941 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[(2-methyl-3-nitrophenyl)methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | Cc1c(CNC2CS(=O)(=O)CC2O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N2O5S/c1-8-9(3-2-4-11(8)14(16)17)5-13-10-6-20(18,19)7-12(10)15/h2-4,10,12-13,15H,5-7H2,1H3 |
| InChIKey | BKWMDWHVTCGXDN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|