C15H14Cl2N2O2 — CID 103114558
N-[(2,6-dichlorophenyl)methyl]-1-(2-methyl-3-nitrophenyl)methanamine (PubChem CID 103114558) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.19 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-1-(2-methyl-3-nitrophenyl)methanamine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-1-(2-methyl-3-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 103114558 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-1-(2-methyl-3-nitrophenyl)methanamine |
| SMILES | Cc1c(CNCc2c(Cl)cccc2Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-10-11(4-2-7-15(10)19(20)21)8-18-9-12-13(16)5-3-6-14(12)17/h2-7,18H,8-9H2,1H3 |
| InChIKey | RMTURABUMFFOCF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|