C11H16ClN3O2 — CID 63746130
N-[(2-chloro-6-nitrophenyl)methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 63746130) has the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. Its IUPAC name is N-[(2-chloro-6-nitrophenyl)methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(2-chloro-6-nitrophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63746130 |
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[(2-chloro-6-nitrophenyl)methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16ClN3O2/c1-14(2)7-6-13-8-9-10(12)4-3-5-11(9)15(16)17/h3-5,13H,6-8H2,1-2H3 |
| InChIKey | YJTKIDWXMLNXSB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|