C12H17ClN2O2 — CID 63747503
N-[(2-chloro-6-nitrophenyl)methyl]-2,2-dimethylpropan-1-amine (PubChem CID 63747503) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is N-[(2-chloro-6-nitrophenyl)methyl]-2,2-dimethylpropan-1-amine.
| Compound Name | N-[(2-chloro-6-nitrophenyl)methyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 63747503 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-[(2-chloro-6-nitrophenyl)methyl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CNCc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17ClN2O2/c1-12(2,3)8-14-7-9-10(13)5-4-6-11(9)15(16)17/h4-6,14H,7-8H2,1-3H3 |
| InChIKey | NYAGXVOAHIQIQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|