C12H15ClN2O2 — CID 63746985
N-[(2-chloro-6-nitrophenyl)methyl]-1-cyclobutylmethanamine (PubChem CID 63746985) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is N-[(2-chloro-6-nitrophenyl)methyl]-1-cyclobutylmethanamine.
| Compound Name | N-[(2-chloro-6-nitrophenyl)methyl]-1-cyclobutylmethanamine |
|---|---|
| PubChem CID | 63746985 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-[(2-chloro-6-nitrophenyl)methyl]-1-cyclobutylmethanamine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1CNCC1CCC1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-11-5-2-6-12(15(16)17)10(11)8-14-7-9-3-1-4-9/h2,5-6,9,14H,1,3-4,7-8H2 |
| InChIKey | PLONBHWJYMMMGG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|