C11H13NO6S — CID 60880094
4-(2-methyl-3-nitrophenoxy)-1,1-dioxothiolan-3-ol (PubChem CID 60880094) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 4-(2-methyl-3-nitrophenoxy)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2-methyl-3-nitrophenoxy)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60880094 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-(2-methyl-3-nitrophenoxy)-1,1-dioxothiolan-3-ol |
| SMILES | Cc1c(OC2CS(=O)(=O)CC2O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO6S/c1-7-8(12(14)15)3-2-4-10(7)18-11-6-19(16,17)5-9(11)13/h2-4,9,11,13H,5-6H2,1H3 |
| InChIKey | JEKXMUORJFLQFA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|