C11H11ClO5S — CID 60885910
2-chloro-6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzaldehyde (PubChem CID 60885910) has the molecular formula C11H11ClO5S and a molecular weight of 290.72 g/mol. Its IUPAC name is 2-chloro-6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzaldehyde.
| Compound Name | 2-chloro-6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 60885910 |
| Molecular Formula | C11H11ClO5S |
| Molecular Weight | 290.72 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-chloro-6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzaldehyde |
| SMILES | O=Cc1c(Cl)cccc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H11ClO5S/c12-8-2-1-3-10(7(8)4-13)17-11-6-18(15,16)5-9(11)14/h1-4,9,11,14H,5-6H2 |
| InChIKey | XNFXOLYVMDCIAU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.72 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|