C11H13FO5S — CID 107698615
4-[4-fluoro-2-(hydroxymethyl)phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 107698615) has the molecular formula C11H13FO5S and a molecular weight of 276.28 g/mol. Its IUPAC name is 4-[4-fluoro-2-(hydroxymethyl)phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-fluoro-2-(hydroxymethyl)phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 107698615 |
| Molecular Formula | C11H13FO5S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-[4-fluoro-2-(hydroxymethyl)phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Oc2ccc(F)cc2CO)C1 |
| InChI | InChI=1S/C11H13FO5S/c12-8-1-2-10(7(3-8)4-13)17-11-6-18(15,16)5-9(11)14/h1-3,9,11,13-14H,4-6H2 |
| InChIKey | ZSUCYBKZBCOYJM-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |