C14H20FNO4S — CID 107695902
4-[4-fluoro-2-(propylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 107695902) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-[4-fluoro-2-(propylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-fluoro-2-(propylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 107695902 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-[4-fluoro-2-(propylaminomethyl)phenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | CCCNCc1cc(F)ccc1OC1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C14H20FNO4S/c1-2-5-16-7-10-6-11(15)3-4-13(10)20-14-9-21(18,19)8-12(14)17/h3-4,6,12,14,16-17H,2,5,7-9H2,1H3 |
| InChIKey | KOHJNSGZLRCWQY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|