C13H19F2NO — CID 107695992
N-[[5-fluoro-2-(3-fluoropropoxy)phenyl]methyl]propan-1-amine (PubChem CID 107695992) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[[5-fluoro-2-(3-fluoropropoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-fluoro-2-(3-fluoropropoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107695992 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[[5-fluoro-2-(3-fluoropropoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)ccc1OCCCF |
| InChI | InChI=1S/C13H19F2NO/c1-2-7-16-10-11-9-12(15)4-5-13(11)17-8-3-6-14/h4-5,9,16H,2-3,6-8,10H2,1H3 |
| InChIKey | IPBORCCWKGCFTR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|