C13H17F4NO — CID 107695788
N-[[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]propan-1-amine (PubChem CID 107695788) has the molecular formula C13H17F4NO and a molecular weight of 279.28 g/mol. Its IUPAC name is N-[[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107695788 |
| Molecular Formula | C13H17F4NO |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[[5-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C13H17F4NO/c1-2-6-18-9-10-8-11(14)3-4-12(10)19-7-5-13(15,16)17/h3-4,8,18H,2,5-7,9H2,1H3 |
| InChIKey | VHSXKXAMQFVWFV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|