C10H7F5O4S — CID 60879356
1,1-dioxo-4-(2,3,4,5,6-pentafluorophenoxy)thiolan-3-ol (PubChem CID 60879356) has the molecular formula C10H7F5O4S and a molecular weight of 318.22 g/mol. Its IUPAC name is 1,1-dioxo-4-(2,3,4,5,6-pentafluorophenoxy)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(2,3,4,5,6-pentafluorophenoxy)thiolan-3-ol |
|---|---|
| PubChem CID | 60879356 |
| Molecular Formula | C10H7F5O4S |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 1,1-dioxo-4-(2,3,4,5,6-pentafluorophenoxy)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(Oc2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C10H7F5O4S/c11-5-6(12)8(14)10(9(15)7(5)13)19-4-2-20(17,18)1-3(4)16/h3-4,16H,1-2H2 |
| InChIKey | ZVODQZKXWNDMQE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|