C11H10FNO4S — CID 107667436
3-fluoro-4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzonitrile (PubChem CID 107667436) has the molecular formula C11H10FNO4S and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-fluoro-4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzonitrile.
| Compound Name | 3-fluoro-4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 107667436 |
| Molecular Formula | C11H10FNO4S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-fluoro-4-(4-hydroxy-1,1-dioxothiolan-3-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(OC2CS(=O)(=O)CC2O)c(F)c1 |
| InChI | InChI=1S/C11H10FNO4S/c12-8-3-7(4-13)1-2-10(8)17-11-6-18(15,16)5-9(11)14/h1-3,9,11,14H,5-6H2 |
| InChIKey | MQOJMYOXTPYGSC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |