About (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate
(4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate (PubChem CID 107669992) has the molecular formula C8H4ClFN2O4S
and a molecular weight of 278.65 g/mol. Its IUPAC name is (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate.
Molecular Properties
| Compound Name | (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate |
| PubChem CID | 107669992 |
| Molecular Formula | C8H4ClFN2O4S |
| Molecular Weight | 278.65 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate |
| SMILES | N#Cc1ccc(OC(=O)NS(=O)(=O)Cl)c(F)c1 |
| InChI | InChI=1S/C8H4ClFN2O4S/c9-17(14,15)12-8(13)16-7-2-1-5(4-11)3-6(7)10/h1-3H,(H,12,13) |
| InChIKey | JBGFPNODPSDTFV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate?
The IUPAC name of (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate (CID 107669992) is (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate.
What is the SMILES notation for (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate?
The canonical SMILES for (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate is N#Cc1ccc(OC(=O)NS(=O)(=O)Cl)c(F)c1.
What is the InChIKey of (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate?
The InChIKey is JBGFPNODPSDTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClFN2O4S/c9-17(14,15)12-8(13)16-7-2-1-5(4-11)3-6(7)10/h1-3H,(H,12,13).
What are the key properties of (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate?
(4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate has a molecular weight of 278.65 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-2-fluorophenyl) N-chlorosulfonylcarbamate is sourced from PubChem (CID 107669992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).