About (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate
(5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate (PubChem CID 107663068) has the molecular formula C9H7ClN2O4S
and a molecular weight of 274.69 g/mol. Its IUPAC name is (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate.
Molecular Properties
| Compound Name | (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate |
| PubChem CID | 107663068 |
| Molecular Formula | C9H7ClN2O4S |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate |
| SMILES | Cc1ccc(C#N)cc1OC(=O)NS(=O)(=O)Cl |
| InChI | InChI=1S/C9H7ClN2O4S/c1-6-2-3-7(5-11)4-8(6)16-9(13)12-17(10,14)15/h2-4H,1H3,(H,12,13) |
| InChIKey | QBTYEZYNZZMFJJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate?
The IUPAC name of (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate (CID 107663068) is (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate.
What is the SMILES notation for (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate?
The canonical SMILES for (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate is Cc1ccc(C#N)cc1OC(=O)NS(=O)(=O)Cl.
What is the InChIKey of (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate?
The InChIKey is QBTYEZYNZZMFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O4S/c1-6-2-3-7(5-11)4-8(6)16-9(13)12-17(10,14)15/h2-4H,1H3,(H,12,13).
What are the key properties of (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate?
(5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate has a molecular weight of 274.69 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-2-methylphenyl) N-chlorosulfonylcarbamate is sourced from PubChem (CID 107663068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).