C11H14N2O3S — CID 107661811
3-(5-cyano-2-methylphenoxy)propane-1-sulfonamide (PubChem CID 107661811) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3-(5-cyano-2-methylphenoxy)propane-1-sulfonamide.
| Compound Name | 3-(5-cyano-2-methylphenoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 107661811 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-(5-cyano-2-methylphenoxy)propane-1-sulfonamide |
| SMILES | Cc1ccc(C#N)cc1OCCCS(N)(=O)=O |
| InChI | InChI=1S/C11H14N2O3S/c1-9-3-4-10(8-12)7-11(9)16-5-2-6-17(13,14)15/h3-4,7H,2,5-6H2,1H3,(H2,13,14,15) |
| InChIKey | OOHQEXSGOYVVPQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|