C17H18N2O — CID 107658274
3-[3-(3-aminophenyl)propoxy]-4-methylbenzonitrile (PubChem CID 107658274) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[3-(3-aminophenyl)propoxy]-4-methylbenzonitrile.
| Compound Name | 3-[3-(3-aminophenyl)propoxy]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 107658274 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-[3-(3-aminophenyl)propoxy]-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1OCCCc1cccc(N)c1 |
| InChI | InChI=1S/C17H18N2O/c1-13-7-8-15(12-18)11-17(13)20-9-3-5-14-4-2-6-16(19)10-14/h2,4,6-8,10-11H,3,5,9,19H2,1H3 |
| InChIKey | FDFMDKJRORSJNK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|