C10H13N3O3S — CID 114385179
2-(4-cyano-2-methoxyanilino)ethanesulfonamide (PubChem CID 114385179) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-(4-cyano-2-methoxyanilino)ethanesulfonamide.
| Compound Name | 2-(4-cyano-2-methoxyanilino)ethanesulfonamide |
|---|---|
| PubChem CID | 114385179 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(4-cyano-2-methoxyanilino)ethanesulfonamide |
| SMILES | COc1cc(C#N)ccc1NCCS(N)(=O)=O |
| InChI | InChI=1S/C10H13N3O3S/c1-16-10-6-8(7-11)2-3-9(10)13-4-5-17(12,14)15/h2-3,6,13H,4-5H2,1H3,(H2,12,14,15) |
| InChIKey | OBIYVGRKZREXIP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |