C14H20N2O3S — CID 103521156
N-(4-cyano-2-methoxyphenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521156) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(4-cyano-2-methoxyphenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(4-cyano-2-methoxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521156 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(4-cyano-2-methoxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | COc1cc(C#N)ccc1NS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C14H20N2O3S/c1-14(2,3)7-8-20(17,18)16-12-6-5-11(10-15)9-13(12)19-4/h5-6,9,16H,7-8H2,1-4H3 |
| InChIKey | DLMAKMQWSPUBBG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |