C14H24N2O4S — CID 103520845
N-(2-amino-4,5-dimethoxyphenyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103520845) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethoxyphenyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-amino-4,5-dimethoxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103520845 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(2-amino-4,5-dimethoxyphenyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | COc1cc(N)c(NS(=O)(=O)CCC(C)(C)C)cc1OC |
| InChI | InChI=1S/C14H24N2O4S/c1-14(2,3)6-7-21(17,18)16-11-9-13(20-5)12(19-4)8-10(11)15/h8-9,16H,6-7,15H2,1-5H3 |
| InChIKey | YJSDZLRDDJIVQZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|