C10H16N2O6S2 — CID 82838671
N-(2-amino-4,5-dimethoxyphenyl)-1-methylsulfonylmethanesulfonamide (PubChem CID 82838671) has the molecular formula C10H16N2O6S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethoxyphenyl)-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-(2-amino-4,5-dimethoxyphenyl)-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82838671 |
| Molecular Formula | C10H16N2O6S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-(2-amino-4,5-dimethoxyphenyl)-1-methylsulfonylmethanesulfonamide |
| SMILES | COc1cc(N)c(NS(=O)(=O)CS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C10H16N2O6S2/c1-17-9-4-7(11)8(5-10(9)18-2)12-20(15,16)6-19(3,13)14/h4-5,12H,6,11H2,1-3H3 |
| InChIKey | VHDJLYRMJUDAFG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|