C11H16N2O4 — CID 83001432
methyl 2-(2-amino-4,5-dimethoxyanilino)acetate (PubChem CID 83001432) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 2-(2-amino-4,5-dimethoxyanilino)acetate.
| Compound Name | methyl 2-(2-amino-4,5-dimethoxyanilino)acetate |
|---|---|
| PubChem CID | 83001432 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl 2-(2-amino-4,5-dimethoxyanilino)acetate |
| SMILES | COC(=O)CNc1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C11H16N2O4/c1-15-9-4-7(12)8(5-10(9)16-2)13-6-11(14)17-3/h4-5,13H,6,12H2,1-3H3 |
| InChIKey | LWYZUZONAFYORF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|