C13H21N3O3 — CID 106275255
3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylpropanamide (PubChem CID 106275255) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylpropanamide.
| Compound Name | 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106275255 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylpropanamide |
| SMILES | COc1cc(N)c(NCC(C)(C)C(N)=O)cc1OC |
| InChI | InChI=1S/C13H21N3O3/c1-13(2,12(15)17)7-16-9-6-11(19-4)10(18-3)5-8(9)14/h5-6,16H,7,14H2,1-4H3,(H2,15,17) |
| InChIKey | BAPQUIAYTFCXQH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|