C13H18N4O2 — CID 106275147
3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106275147) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106275147 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNc1cc2c(cc1N)CC(=O)N2)C(N)=O |
| InChI | InChI=1S/C13H18N4O2/c1-13(2,12(15)19)6-16-10-5-9-7(3-8(10)14)4-11(18)17-9/h3,5,16H,4,6,14H2,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | ZIWCHTRQABQRRQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|