C14H20N4O2 — CID 106275365
3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106275365) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275365 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-[(5-amino-2-oxo-1,3-dihydroindol-6-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,13(20)16-3)7-17-11-6-10-8(4-9(11)15)5-12(19)18-10/h4,6,17H,5,7,15H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | SUHXHASPDHKHHR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|