C14H21N3O2 — CID 106140691
5-amino-6-[(4-hydroxy-2,2-dimethylbutyl)amino]-1,3-dihydroindol-2-one (PubChem CID 106140691) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-amino-6-[(4-hydroxy-2,2-dimethylbutyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[(4-hydroxy-2,2-dimethylbutyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106140691 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 5-amino-6-[(4-hydroxy-2,2-dimethylbutyl)amino]-1,3-dihydroindol-2-one |
| SMILES | CC(C)(CCO)CNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,3-4-18)8-16-12-7-11-9(5-10(12)15)6-13(19)17-11/h5,7,16,18H,3-4,6,8,15H2,1-2H3,(H,17,19) |
| InChIKey | ZOLFMYYPVPVUIC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|