C10H14N4O — CID 62480998
5-amino-6-(2-aminoethylamino)-1,3-dihydroindol-2-one (PubChem CID 62480998) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-amino-6-(2-aminoethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(2-aminoethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62480998 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 5-amino-6-(2-aminoethylamino)-1,3-dihydroindol-2-one |
| SMILES | NCCNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C10H14N4O/c11-1-2-13-9-5-8-6(3-7(9)12)4-10(15)14-8/h3,5,13H,1-2,4,11-12H2,(H,14,15) |
| InChIKey | VATLXWAYOHDXBE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|