C17H27N3O — CID 107814730
5-amino-6-(7-methyloctylamino)-1,3-dihydroindol-2-one (PubChem CID 107814730) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 5-amino-6-(7-methyloctylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(7-methyloctylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 107814730 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 5-amino-6-(7-methyloctylamino)-1,3-dihydroindol-2-one |
| SMILES | CC(C)CCCCCCNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C17H27N3O/c1-12(2)7-5-3-4-6-8-19-16-11-15-13(9-14(16)18)10-17(21)20-15/h9,11-12,19H,3-8,10,18H2,1-2H3,(H,20,21) |
| InChIKey | DGLAEVSGQMZMFN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|