C16H25N3O — CID 107819817
5-amino-6-(2-ethylhexylamino)-1,3-dihydroindol-2-one (PubChem CID 107819817) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-amino-6-(2-ethylhexylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(2-ethylhexylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 107819817 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-amino-6-(2-ethylhexylamino)-1,3-dihydroindol-2-one |
| SMILES | CCCCC(CC)CNc1cc2c(cc1N)CC(=O)N2 |
| InChI | InChI=1S/C16H25N3O/c1-3-5-6-11(4-2)10-18-15-9-14-12(7-13(15)17)8-16(20)19-14/h7,9,11,18H,3-6,8,10,17H2,1-2H3,(H,19,20) |
| InChIKey | VOQFRULWFUUTFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|