C18H22N2O5 — CID 28867945
N-(2-amino-4,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 28867945) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-(2-amino-4,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 28867945 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(2-amino-4,5-dimethoxyphenyl)-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2cc(OC)c(OC)cc2N)cc1OC |
| InChI | InChI=1S/C18H22N2O5/c1-22-14-6-5-11(7-15(14)23-2)8-18(21)20-13-10-17(25-4)16(24-3)9-12(13)19/h5-7,9-10H,8,19H2,1-4H3,(H,20,21) |
| InChIKey | OUCLDMRSYFDKQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|