C14H16N2O3S — CID 43549128
N-(2-amino-4,5-dimethoxyphenyl)-2-thiophen-3-ylacetamide (PubChem CID 43549128) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethoxyphenyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-amino-4,5-dimethoxyphenyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 43549128 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-(2-amino-4,5-dimethoxyphenyl)-2-thiophen-3-ylacetamide |
| SMILES | COc1cc(N)c(NC(=O)Cc2ccsc2)cc1OC |
| InChI | InChI=1S/C14H16N2O3S/c1-18-12-6-10(15)11(7-13(12)19-2)16-14(17)5-9-3-4-20-8-9/h3-4,6-8H,5,15H2,1-2H3,(H,16,17) |
| InChIKey | YDWVIBCUVVZAFU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|