C12H11NO3S2 — CID 43408027
methyl 3-[(2-thiophen-3-ylacetyl)amino]thiophene-2-carboxylate (PubChem CID 43408027) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 3-[(2-thiophen-3-ylacetyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-thiophen-3-ylacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43408027 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | methyl 3-[(2-thiophen-3-ylacetyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C12H11NO3S2/c1-16-12(15)11-9(3-5-18-11)13-10(14)6-8-2-4-17-7-8/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | FJFODWSOPPXAGW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |