C9H9N5O3S — CID 110499554
methyl 3-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 110499554) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is methyl 3-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 110499554 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | methyl 3-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)Cc1nn[nH]n1 |
| InChI | InChI=1S/C9H9N5O3S/c1-17-9(16)8-5(2-3-18-8)10-7(15)4-6-11-13-14-12-6/h2-3H,4H2,1H3,(H,10,15)(H,11,12,13,14) |
| InChIKey | KFOSEPGEFVNPQO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |