C9H10BrNO3S — CID 69190095
methyl 3-(3-bromopropanoylamino)thiophene-2-carboxylate (PubChem CID 69190095) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is methyl 3-(3-bromopropanoylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(3-bromopropanoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 69190095 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | methyl 3-(3-bromopropanoylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CCBr |
| InChI | InChI=1S/C9H10BrNO3S/c1-14-9(13)8-6(3-5-15-8)11-7(12)2-4-10/h3,5H,2,4H2,1H3,(H,11,12) |
| InChIKey | IAPRRJROCSRSOK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|