C9H8N2O3S — CID 5178717
methyl 3-[(2-cyanoacetyl)amino]thiophene-2-carboxylate (PubChem CID 5178717) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is methyl 3-[(2-cyanoacetyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-cyanoacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5178717 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | methyl 3-[(2-cyanoacetyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CC#N |
| InChI | InChI=1S/C9H8N2O3S/c1-14-9(13)8-6(3-5-15-8)11-7(12)2-4-10/h3,5H,2H2,1H3,(H,11,12) |
| InChIKey | CBTIZGFRAOOIEI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |