C12H17NO4S2 — CID 103706057
methyl 3-[[2-(3-hydroxybutan-2-ylsulfanyl)acetyl]amino]thiophene-2-carboxylate (PubChem CID 103706057) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is methyl 3-[[2-(3-hydroxybutan-2-ylsulfanyl)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(3-hydroxybutan-2-ylsulfanyl)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103706057 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 3-[[2-(3-hydroxybutan-2-ylsulfanyl)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CSC(C)C(C)O |
| InChI | InChI=1S/C12H17NO4S2/c1-7(14)8(2)19-6-10(15)13-9-4-5-18-11(9)12(16)17-3/h4-5,7-8,14H,6H2,1-3H3,(H,13,15) |
| InChIKey | QEJPPTBAFTUSHG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |