C12H17NO3S2 — CID 43409254
methyl 3-[(2-butylsulfanylacetyl)amino]thiophene-2-carboxylate (PubChem CID 43409254) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is methyl 3-[(2-butylsulfanylacetyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(2-butylsulfanylacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43409254 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | methyl 3-[(2-butylsulfanylacetyl)amino]thiophene-2-carboxylate |
| SMILES | CCCCSCC(=O)Nc1ccsc1C(=O)OC |
| InChI | InChI=1S/C12H17NO3S2/c1-3-4-6-17-8-10(14)13-9-5-7-18-11(9)12(15)16-2/h5,7H,3-4,6,8H2,1-2H3,(H,13,14) |
| InChIKey | VTYYEQFNWMNDCA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|