C13H11ClN2O3S2 — CID 11837292
methyl 3-[[2-[(5-chloro-2-pyridinyl)sulfanyl]acetyl]amino]thiophene-2-carboxylate (PubChem CID 11837292) has the molecular formula C13H11ClN2O3S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is methyl 3-[[2-[(5-chloro-2-pyridinyl)sulfanyl]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[(5-chloro-2-pyridinyl)sulfanyl]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 11837292 |
| Molecular Formula | C13H11ClN2O3S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | methyl 3-[[2-[(5-chloro-2-pyridinyl)sulfanyl]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CSc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11ClN2O3S2/c1-19-13(18)12-9(4-5-20-12)16-10(17)7-21-11-3-2-8(14)6-15-11/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | QCUAFYJPNNJPIV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |