C14H12ClIN2OS — CID 112815581
2-[(5-chloro-2-pyridinyl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 112815581) has the molecular formula C14H12ClIN2OS and a molecular weight of 418.69 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 112815581 |
| Molecular Formula | C14H12ClIN2OS |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H12ClIN2OS/c1-9-6-11(16)3-4-12(9)18-13(19)8-20-14-5-2-10(15)7-17-14/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | QUAKDNROGXGUBJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|