C14H14N2O3S2 — CID 25116305
methyl 3-[[2-(4-aminophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate (PubChem CID 25116305) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 3-[[2-(4-aminophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-aminophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25116305 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | methyl 3-[[2-(4-aminophenyl)sulfanylacetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CSc1ccc(N)cc1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-19-14(18)13-11(6-7-20-13)16-12(17)8-21-10-4-2-9(15)3-5-10/h2-7H,8,15H2,1H3,(H,16,17) |
| InChIKey | RUEWOMPEQCJHRH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|