C16H14Cl2N2O3S — CID 54154831
methyl 2-[[2-(4-aminophenyl)sulfanylacetyl]amino]-4,6-dichlorobenzoate (PubChem CID 54154831) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is methyl 2-[[2-(4-aminophenyl)sulfanylacetyl]amino]-4,6-dichlorobenzoate.
| Compound Name | methyl 2-[[2-(4-aminophenyl)sulfanylacetyl]amino]-4,6-dichlorobenzoate |
|---|---|
| PubChem CID | 54154831 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | methyl 2-[[2-(4-aminophenyl)sulfanylacetyl]amino]-4,6-dichlorobenzoate |
| SMILES | COC(=O)c1c(Cl)cc(Cl)cc1NC(=O)CSc1ccc(N)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-23-16(22)15-12(18)6-9(17)7-13(15)20-14(21)8-24-11-4-2-10(19)3-5-11/h2-7H,8,19H2,1H3,(H,20,21) |
| InChIKey | OKHGXFAISYAGPT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|