C19H18Cl2FNO3S — CID 67726333
methyl 2,4-dichloro-6-[[2-[3-(2-fluorophenyl)propylsulfanyl]acetyl]amino]benzoate (PubChem CID 67726333) has the molecular formula C19H18Cl2FNO3S and a molecular weight of 430.33 g/mol. Its IUPAC name is methyl 2,4-dichloro-6-[[2-[3-(2-fluorophenyl)propylsulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2,4-dichloro-6-[[2-[3-(2-fluorophenyl)propylsulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 67726333 |
| Molecular Formula | C19H18Cl2FNO3S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | methyl 2,4-dichloro-6-[[2-[3-(2-fluorophenyl)propylsulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1c(Cl)cc(Cl)cc1NC(=O)CSCCCc1ccccc1F |
| InChI | InChI=1S/C19H18Cl2FNO3S/c1-26-19(25)18-14(21)9-13(20)10-16(18)23-17(24)11-27-8-4-6-12-5-2-3-7-15(12)22/h2-3,5,7,9-10H,4,6,8,11H2,1H3,(H,23,24) |
| InChIKey | XZZHKVIAMRKCTB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|